CAS 1219982-99-6

3-Amino-4-chloro-N-(3-hydroxybutyl)benzenesulfonamide

Description:

3-Amino-4-chloro-N-(3-hydroxybutyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of an amino group and a chloro substituent on the benzene ring contributes to its reactivity and potential biological activity. The hydroxybutyl side chain enhances its solubility and may influence its pharmacokinetic properties. This compound is likely to exhibit polar characteristics due to the sulfonamide and hydroxy groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many sulfonamides, it may also exhibit a range of biological activities, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed due to potential toxicity and reactivity associated with similar compounds.

Formula: C₁₀H₁₅ClN₂O₃S

InChI: InChI=1S/C10H15ClN2O3S/c1-7(14)4-5-13-17(15,16)8-2-3-9(11)10(12)6-8/h2-3,6-7,13-14H,4-5,12H2,1H3

InChI key: InChIKey=WNSOFDSFPYHWRC-UHFFFAOYSA-N

SMILES: S(NCCC(C)O)(=O)(=O)C1=CC(N)=C(Cl)C=C1

Synonyms:

• Benzenesulfonamide, 3-amino-4-chloro-N-(3-hydroxybutyl)-
• 3-Amino-4-chloro-N-(3-hydroxybutyl)benzenesulfonamide