CAS 122-16-7: Sulfanitran
Description:Sulfanitran, with the CAS number 122-16-7, is an organic compound that belongs to the class of sulfonamides. It is characterized by its sulfonamide functional group, which consists of a sulfur atom bonded to a nitrogen atom and an aromatic ring. This compound is typically a white to light yellow crystalline solid and is known for its use in agricultural applications, particularly as a herbicide. Sulfanitran exhibits moderate solubility in water and is more soluble in organic solvents, which influences its behavior in various environmental conditions. The compound acts by inhibiting specific biochemical pathways in plants, leading to growth regulation. Additionally, sulfanitran has been studied for its potential effects on non-target organisms, raising considerations regarding its environmental impact and safety. As with many sulfonamides, it may also possess antibacterial properties, although its primary application remains in agriculture. Proper handling and usage guidelines are essential due to its chemical nature and potential toxicity.
Formula:C14H13N3O5S
InChI:InChI=1S/C14H13N3O5S/c1-10(18)15-11-4-8-14(9-5-11)23(21,22)16-12-2-6-13(7-3-12)17(19)20/h2-9,16H,1H3,(H,15,18)
InChI key:InChIKey=GWBPFRGXNGPPMF-UHFFFAOYSA-N
SMILES:O=C(NC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)N(=O)=O)C
- Synonyms:
- 4-(4-Nitrophenylsulfamoyl)Acetanilide
- 4′-[(p-Nitrophenyl)sulfamoyl]acetanilide
- Acetamide, N-[4-[[(4-nitrophenyl)amino]sulfonyl]phenyl]-
- Acetanilide, 4′-[(p-nitrophenyl)sulfamoyl]-
- N-[4-[[(4-Nitrophenyl)amino]sulfonyl]phenyl]acetamide
- N-{4-[(4-nitrophenyl)sulfamoyl]phenyl}acetamide
- N<sup>4</sup>-Acetyl-4′-nitrosulfanilanilide
- N<sup>4</sup>-Acetyl-N<sup>1</sup>-(4-nitrophenyl)sulfanilamide
- N<sup>4</sup>-Acetyl-N<sup>1</sup>-(p-nitrophenyl)sulfanilamide
- NSC 217299
- See more synonyms
- NSC 77120
- Sulfanitran
- N4-Acetyl-N1-(p-nitrophenyl)sulfanilamide
- N4-Acetyl-N1-(4-nitrophenyl)sulfanilamide