CAS 122-63-4
:Benzyl propionate
Description:
Benzyl propionate is an organic compound classified as an ester, formed from the reaction of benzyl alcohol and propionic acid. It is typically a colorless to pale yellow liquid with a sweet, fruity aroma, making it useful in the fragrance and flavoring industries. The compound is known for its low volatility and relatively high boiling point, which contributes to its stability in various applications. Benzyl propionate is soluble in organic solvents but has limited solubility in water. It is often employed as a fixative in perfumes and as a flavoring agent in food products. Additionally, it has applications in the cosmetic industry due to its pleasant scent and potential skin-conditioning properties. While generally considered safe for use in regulated amounts, it is important to handle it with care, as it may cause irritation in sensitive individuals. As with many esters, it can undergo hydrolysis in the presence of water, leading to the release of its constituent alcohol and acid.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3
InChI key:InChIKey=VHOMAPWVLKRQAZ-UHFFFAOYSA-N
SMILES:C(OC(CC)=O)C1=CC=CC=C1
Synonyms:- Benzyl Propanoate
- NSC 46100
- Phenylmethyl propanoate
- Propanoic Acid, Phenylmethyl Ester
- Propionic acid, benzyl ester
- Benzyl propionate
- Benzyl Propionate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Propanoic acid, phenylmethyl ester
CAS:Formula:C10H12O2Purity:97%Color and Shape:LiquidMolecular weight:164.2011Ref: 54-OR93669
2.5lTo inquire25gTo inquire25lTo inquire25mlTo inquire100gTo inquire100mlTo inquire500mlTo inquireBenzyl propionate
CAS:Formula:CH3CH2CO2CH2C6H5Purity:≥ 99.0%Color and Shape:Clear, colourless to almost colourless liquidMolecular weight:164.21Benzyl propionate
CAS:Benzyl propionate exhibits broad-spectrum antifungal activity against pathogens such as Phyllosticta zingiberi, Fusarium solani, and Magnaporthe oryzae, and is a key inhibitory compound produced by the strain ETR-B22 against various fungal pathogens.Formula:C10H12O2Purity:99.81%Color and Shape:SolidMolecular weight:164.2Benzyl Propionate
CAS:Formula:C10H12O2Purity:>99.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:164.20







