CAS 122-74-7
:3-Phenylpropyl propionate
Description:
3-Phenylpropyl propionate, with the CAS number 122-74-7, is an organic compound classified as an ester. It is formed from the reaction of propionic acid and 3-phenylpropanol. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor, making it useful in the fragrance and flavoring industries. Its molecular structure features a phenyl group attached to a propyl chain, contributing to its aromatic properties. 3-Phenylpropyl propionate is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. It is often utilized in the formulation of perfumes, cosmetics, and food flavorings due to its appealing scent profile. Additionally, like many esters, it may exhibit low toxicity, but safety data should always be consulted for handling and usage guidelines. Overall, this compound exemplifies the characteristics typical of aromatic esters, combining both functional and sensory attributes that make it valuable in various applications.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c1-2-12(13)14-10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3
InChI key:InChIKey=GTNCESCYZPMXCJ-UHFFFAOYSA-N
SMILES:C(CCOC(CC)=O)C1=CC=CC=C1
Synonyms:- Benzenepropanol, 1-propanoate
- 3-Phenylpropyl propionate
- NSC 6032
- Benzenepropanol, propanoate
- 1-Propanol, 3-phenyl-, propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
