CAS 1220-99-1
:1-(5,5-dioxido-10H-phenothiazin-10-yl)ethanone
Description:
1-(5,5-Dioxido-10H-phenothiazin-10-yl)ethanone, with CAS number 1220-99-1, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a phenothiazine core with a ketone functional group at the ethyl position, contributing to its reactivity and potential applications. The presence of the dioxido group indicates that it has two oxygen atoms double-bonded to the sulfur atom, which can influence its chemical behavior and stability. Typically, compounds in this class exhibit biological activity, making them of interest in medicinal chemistry, particularly in the development of antipsychotic and antihistaminic agents. The molecular structure suggests that it may also participate in various chemical reactions, including oxidation and reduction processes. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.
Formula:C14H11NO3S
InChI:InChI=1/C14H11NO3S/c1-10(16)15-11-6-2-4-8-13(11)19(17,18)14-9-5-3-7-12(14)15/h2-9H,1H3
SMILES:CC(=O)N1c2ccccc2S(=O)(=O)c2ccccc12
Synonyms:- 10H-Phenothiazine, 10-acetyl-, 5,5-dioxide
- ethanone, 1-(5,5-dioxido-10H-phenothiazin-10-yl)-
- N-Acetylphenothiazine S,S-dioxide
- Phenothiazine, 10-acetyl-, 5,5-dioxide
- 1-(5,5-Dioxido-10H-phenothiazin-10-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

