CAS 1220016-35-2

Pyrrolidine, 3-[(4-ethoxyphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-ethoxyphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 4-ethoxyphenoxy group indicates that it has an ether functional group linked to a phenyl ring, contributing to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as moderate to high polarity due to the presence of both the ether and amine functionalities, influencing its interaction with biological systems. Its structure suggests potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies.

Formula: C₁₃H₁₉NO₂·ClH

InChI: InChI=1S/C13H19NO2.ClH/c1-2-15-12-3-5-13(6-4-12)16-10-11-7-8-14-9-11;/h3-6,11,14H,2,7-10H2,1H3;1H

InChI key: InChIKey=OUKODURPFRNELM-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC=C(OCC)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-ethoxyphenoxy)methyl]-, hydrochloride (1:1)