CAS 1220016-37-4

Acetamide, N-(2-methoxyethyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-(2-methoxyethyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to engage in hydrogen bonding. The presence of the methoxyethyl group contributes to its solubility in organic solvents, while the methylamino group suggests basic properties, allowing it to interact with acids to form hydrochloride salts. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety data and handling precautions should be considered, as with any chemical, due to potential toxicity or reactivity. Overall, this compound's unique structural features and properties make it a subject of interest in various chemical and biological studies.

Formula: C₆H₁₄N₂O₂·ClH

InChI: InChI=1S/C6H14N2O2.ClH/c1-7-5-6(9)8-3-4-10-2;/h7H,3-5H2,1-2H3,(H,8,9);1H

InChI key: InChIKey=ANCRPGJQEFSHAS-UHFFFAOYSA-N

SMILES: N(C(CNC)=O)CCOC.Cl

Synonyms:

• Acetamide, N-(2-methoxyethyl)-2-(methylamino)-, hydrochloride (1:1)

N-(2-Methoxy-ethyl)-2-methylamino-acetamide hydrochloride

CAS: 1220016-37-4

Versatile small molecule scaffold

Formula: C₆H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 182.65 g/mol

Ref: 3D-VYB01637