CAS 1220016-58-9

Piperidine, 3-[2-[4-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[4-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a phenoxy group substituted with an isopropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological effects, including analgesic and anti-inflammatory properties. The compound's molecular structure indicates it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, its hydrochloride form implies that it may exhibit stability and ease of handling in laboratory settings. Overall, this compound exemplifies the diverse functionalities that can arise from modifications of basic organic structures, particularly in the context of drug development and synthesis.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-13(2)15-5-7-16(8-6-15)18-11-9-14-4-3-10-17-12-14;/h5-8,13-14,17H,3-4,9-12H2,1-2H3;1H

InChI key: InChIKey=NHDPYEWKWLARAG-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=CC=C(C(C)C)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-[4-(1-methylethyl)phenoxy]ethyl]-, hydrochloride (1:1)