
CAS 1220016-61-4
:Piperidine, 3-[2-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted biphenyl moiety, indicating the presence of a chlorine atom attached to a biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or literature reference for precise values. Safety data should also be consulted, as the presence of chlorine and the piperidine structure may pose certain hazards.
Formula:C19H22ClNO·ClH
InChI:InChI=1S/C19H22ClNO.ClH/c20-18-13-17(16-6-2-1-3-7-16)8-9-19(18)22-12-10-15-5-4-11-21-14-15;/h1-3,6-9,13,15,21H,4-5,10-12,14H2;1H
InChI key:InChIKey=ZFENCMGYEWCIJO-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1OCCC2CCCNC2)C3=CC=CC=C3.Cl
Synonyms:- Piperidine, 3-[2-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.