CAS 1220016-66-9

4-Chloro-6-(2-methyl-1-piperidinyl)-1,3,5-triazin-2-amine

Description:

4-Chloro-6-(2-methyl-1-piperidinyl)-1,3,5-triazin-2-amine is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. The presence of a chloro group at the 4-position and a 2-methyl-1-piperidinyl substituent at the 6-position contributes to its unique chemical properties. This compound is typically classified as a heterocyclic amine and may exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential interactions with biological targets, possibly influencing its solubility, stability, and reactivity. The compound's molecular weight, melting point, and solubility characteristics would be essential for understanding its behavior in various environments, including biological systems. Additionally, safety and handling considerations are crucial, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, 4-Chloro-6-(2-methyl-1-piperidinyl)-1,3,5-triazin-2-amine represents a significant compound for further exploration in medicinal chemistry and related fields.

Formula: C₉H₁₄ClN₅

InChI: InChI=1S/C9H14ClN5/c1-6-4-2-3-5-15(6)9-13-7(10)12-8(11)14-9/h6H,2-5H2,1H3,(H2,11,12,13,14)

InChI key: InChIKey=MOCIDGCPSDMNAN-UHFFFAOYSA-N

SMILES: CC1N(CCCC1)C=2N=C(Cl)N=C(N)N2