CAS 1220016-70-5

Piperidine, 3-[[4-chloro-2-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[4-chloro-2-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a chlorinated phenyl group substituted with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water and may affect its stability and bioavailability. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. The specific structural features, including the chloro and tert-butyl substituents, may contribute to its pharmacological properties, making it of interest in research and development. As with many chemical substances, safety data and handling precautions should be considered due to potential toxicity or reactivity.

Formula: C₁₆H₂₅Cl₂NO

InChI: InChI=1S/C16H24ClNO.ClH/c1-16(2,3)14-9-13(17)6-7-15(14)19-11-12-5-4-8-18-10-12;/h6-7,9,12,18H,4-5,8,10-11H2,1-3H3;1H

InChI key: InChIKey=PGBVNMQWKYAWTP-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(C(C)(C)C)C=C(Cl)C=C2.Cl

Synonyms:

• Piperidine, 3-[[4-chloro-2-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)
• 3-{[2-(tert-Butyl)-4-chlorophenoxy]-methyl}piperidine hydrochloride