CymitQuimica logo

CAS 1220016-76-1

:

4-Bromo-N<sup>1</sup>,N<sup>1</sup>-di-2-propen-1-yl-1,2-benzenediamine

Description:
4-Bromo-N^1,N^1-di-2-propen-1-yl-1,2-benzenediamine is an organic compound characterized by its complex structure, which includes a bromine atom and two propenyl groups attached to a benzene ring with two amine functional groups. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine substituent may also impart unique reactivity, making it a potential candidate for further chemical transformations. Additionally, the propenyl groups can participate in various reactions, including polymerization or addition reactions, due to their unsaturated nature. The compound's molecular structure suggests it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would require experimental determination or detailed literature references for precise values. Safety data should also be consulted due to the potential hazards associated with brominated compounds and amines.
Formula:C12H15BrN2
InChI:InChI=1S/C12H15BrN2/c1-3-7-15(8-4-2)12-6-5-10(13)9-11(12)14/h3-6,9H,1-2,7-8,14H2
InChI key:InChIKey=VXPGJAPXBAQENG-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=C(N)C=C(Br)C=C1
Synonyms:
  • 4-Bromo-N1,N1-di-2-propen-1-yl-1,2-benzenediamine
  • 1,2-Benzenediamine, 4-bromo-N1,N1-di-2-propen-1-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.