
CAS 1220016-79-4
:Piperidine, 3-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a chloro substituent and a phenoxy group contributes to its unique reactivity and potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the phenyl and piperidine moieties that are often associated with various biological activities. As with many organic compounds, it is essential to handle this substance with care, observing appropriate safety protocols, as it may exhibit toxicity or other hazardous properties. Its specific characteristics, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from reliable chemical databases.
Formula:C20H24ClNO·ClH
InChI:InChI=1S/C20H24ClNO.ClH/c1-20(2,15-7-4-3-5-8-15)16-10-11-19(18(21)13-16)23-17-9-6-12-22-14-17;/h3-5,7-8,10-11,13,17,22H,6,9,12,14H2,1-2H3;1H
InChI key:InChIKey=UEXBITWQKFORRP-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC(Cl)=C(OC2CCCNC2)C=C1)C3=CC=CC=C3.Cl
Synonyms:- Piperidine, 3-[2-chloro-4-(1-methyl-1-phenylethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.