CymitQuimica logo

CAS 1220016-88-5

:

5-Bromo-3-methyl-2-(1-pyrrolidinyl)pyridine

Description:
5-Bromo-3-methyl-2-(1-pyrrolidinyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2-position with a pyrrolidine moiety. The presence of the methyl group at the 3-position contributes to its overall hydrophobic character. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of neuropharmacology and as a scaffold for synthesizing various pharmacologically active compounds. Its structure allows for interactions with biological targets, making it of interest in the development of therapeutics. The bromine substituent can also enhance the compound's reactivity and influence its pharmacokinetic properties. As with many heterocycles, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds.
Formula:C10H13BrN2
InChI:InChI=1S/C10H13BrN2/c1-8-6-9(11)7-12-10(8)13-4-2-3-5-13/h6-7H,2-5H2,1H3
InChI key:InChIKey=BZEGKJPCIKOKKL-UHFFFAOYSA-N
SMILES:CC1=C(N2CCCC2)N=CC(Br)=C1
Synonyms:
  • 5-Bromo-3-methyl-2-(1-pyrrolidinyl)pyridine
  • Pyridine, 5-bromo-3-methyl-2-(1-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.