CAS 1220016-94-3
:4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-1-piperazineethanol
Description:
4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-1-piperazineethanol is a chemical compound characterized by its complex structure, which includes a triazine ring and a piperazine moiety. The presence of the amino and chloro groups on the triazine ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in its ring structure. It is soluble in polar solvents, which is common for compounds containing hydroxyl groups, such as the ethanol part of its structure. The compound may exhibit properties such as antimicrobial or herbicidal activity, making it of interest in agricultural and pharmaceutical applications. Its specific interactions and mechanisms of action would depend on its molecular configuration and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C9H15ClN6O
InChI:InChI=1S/C9H15ClN6O/c10-7-12-8(11)14-9(13-7)16-3-1-15(2-4-16)5-6-17/h17H,1-6H2,(H2,11,12,13,14)
InChI key:InChIKey=FATTULMSCULBKH-UHFFFAOYSA-N
SMILES:ClC1=NC(N2CCN(CCO)CC2)=NC(N)=N1
Synonyms:- 1-Piperazineethanol, 4-(4-amino-6-chloro-1,3,5-triazin-2-yl)-
- 4-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-1-piperazineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.