CAS 1220016-97-6

Piperidine, 3-[2-(cyclobutylmethoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(cyclobutylmethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a cyclobutylmethoxy group attached to the piperidine nitrogen at the 3-position, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various applications in pharmaceutical and chemical research. The presence of the cyclobutyl group may influence its biological activity and interaction with biological targets. This compound is likely to exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations. As with many piperidine derivatives, it may be of interest in the development of therapeutic agents or as a building block in organic synthesis.

Formula: C₁₂H₂₃NO·ClH

InChI: InChI=1S/C12H23NO.ClH/c1-3-12(4-1)10-14-8-6-11-5-2-7-13-9-11;/h11-13H,1-10H2;1H

InChI key: InChIKey=NQYJPDAKOOTEJD-UHFFFAOYSA-N

SMILES: C(OCCC1CCCNC1)C2CCC2.Cl

Synonyms:

• Piperidine, 3-[2-(cyclobutylmethoxy)ethyl]-, hydrochloride (1:1)