CAS 1220017-15-1
:5-Bromo-2-(2-ethyl-1-piperidinyl)-3-methylpyridine
Description:
5-Bromo-2-(2-ethyl-1-piperidinyl)-3-methylpyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a piperidine moiety. The presence of the bromine atom introduces halogen characteristics, which can influence the compound's reactivity and solubility. The piperidine group contributes to the compound's basicity and potential interactions with biological systems, making it of interest in medicinal chemistry. The ethyl group on the piperidine ring adds to the steric bulk, potentially affecting the compound's pharmacokinetics and binding affinity to biological targets. This compound may exhibit various properties such as lipophilicity, which can influence its ability to cross biological membranes. Additionally, its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Overall, the combination of the bromine substitution and the piperidine structure makes this compound a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C13H19BrN2
InChI:InChI=1S/C13H19BrN2/c1-3-12-6-4-5-7-16(12)13-10(2)8-11(14)9-15-13/h8-9,12H,3-7H2,1-2H3
InChI key:InChIKey=VPSFXKAONTZEKE-UHFFFAOYSA-N
SMILES:C(C)C1N(CCCC1)C2=C(C)C=C(Br)C=N2
Synonyms:- 5-Bromo-2-(2-ethyl-1-piperidinyl)-3-methylpyridine
- Pyridine, 5-bromo-2-(2-ethyl-1-piperidinyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.