CAS 1220017-24-2

Ethanone, 1-[4-(2-hydroxyethyl)-1-piperazinyl]-2-(methylamino)-, hydrochloride (1:1)

Description:

Ethanone, 1-[4-(2-hydroxyethyl)-1-piperazinyl]-2-(methylamino)-, hydrochloride (1:1), with CAS number 1220017-24-2, is a chemical compound characterized by its complex structure that includes a piperazine ring, a hydroxyl group, and a methylamino group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical formulations. The presence of the hydroxyl group suggests potential for hydrogen bonding, which may influence its biological activity and interaction with other molecules. The piperazine moiety is often associated with psychoactive properties, making this compound of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for practical applications and further research. As with many chemical substances, safety data sheets should be consulted to understand its handling, storage, and potential hazards.

Formula: C₉H₁₉N₃O₂·ClH

InChI: InChI=1S/C9H19N3O2.ClH/c1-10-8-9(14)12-4-2-11(3-5-12)6-7-13;/h10,13H,2-8H2,1H3;1H

InChI key: InChIKey=DCORFKAEDGNRQM-UHFFFAOYSA-N

SMILES: C(CNC)(=O)N1CCN(CCO)CC1.Cl

Synonyms:

• Ethanone, 1-[4-(2-hydroxyethyl)-1-piperazinyl]-2-(methylamino)-, hydrochloride (1:1)