CymitQuimica logo

CAS 1220017-34-4

:

3-Pyridinecarboxylic acid, 2-[[3-(dimethylamino)propyl]amino]-, hydrochloride (1:1)

Description:
3-Pyridinecarboxylic acid, 2-[[3-(dimethylamino)propyl]amino]-, hydrochloride (1:1), also known as a derivative of pyridine, features a pyridine ring substituted with a carboxylic acid group and a dimethylaminopropyl side chain. This compound is characterized by its basicity due to the presence of the dimethylamino group, which can accept protons, making it soluble in water, particularly in its hydrochloride form. The carboxylic acid group contributes to its acidic properties, allowing for potential interactions in biological systems. The hydrochloride salt form enhances its stability and solubility, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a building block in drug synthesis. Its molecular structure suggests it could participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, this compound's unique combination of functional groups positions it as a versatile entity in both chemical research and medicinal chemistry.
Formula:C11H17N3O2·ClH
InChI:InChI=1S/C11H17N3O2.ClH/c1-14(2)8-4-7-13-10-9(11(15)16)5-3-6-12-10;/h3,5-6H,4,7-8H2,1-2H3,(H,12,13)(H,15,16);1H
InChI key:InChIKey=LMDPOPNTUIBIER-UHFFFAOYSA-N
SMILES:N(CCCN(C)C)C1=C(C(O)=O)C=CC=N1.Cl
Synonyms:
  • 3-Pyridinecarboxylic acid, 2-[[3-(dimethylamino)propyl]amino]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.