CAS 1220017-41-3

3-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)

Description:

3-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a cyclohexyl group and a methyl group attached to the nitrogen atom of the piperidine, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and chemical research. The presence of the hydrochloride indicates that it is a protonated form, which can influence its reactivity and interaction with biological systems. The compound may exhibit basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its specific applications and biological activity would depend on further studies, but compounds of this nature are often investigated for their potential therapeutic effects or as intermediates in organic synthesis.

Formula: C₁₂H₂₄N₂·2ClH

InChI: InChI=1S/C12H24N2.2ClH/c1-14(11-6-3-2-4-7-11)12-8-5-9-13-10-12;;/h11-13H,2-10H2,1H3;2*1H

InChI key: InChIKey=DPIJPZZXDPONBH-UHFFFAOYSA-N

SMILES: N(C)(C1CCCCC1)C2CCCNC2.Cl

Synonyms:

• 3-Piperidinamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)