CAS 1220017-43-5
:6-Chloro-N,N-diethyl-2-pyridinamine
Description:
6-Chloro-N,N-diethyl-2-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent at the 6-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The N,N-diethyl substituents indicate that the compound has two ethyl groups attached to the nitrogen atom, enhancing its lipophilicity and potentially influencing its biological activity. This compound may exhibit properties typical of amines, such as basicity and nucleophilicity, making it useful in organic synthesis and medicinal chemistry. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many nitrogen-containing compounds, due to potential toxicity or reactivity. As with any chemical, understanding its properties, including solubility, stability, and reactivity, is crucial for its effective use in research and industry.
Formula:C9H13ClN2
InChI:InChI=1S/C9H13ClN2/c1-3-12(4-2)9-7-5-6-8(10)11-9/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=VQNKGKIYJFALNH-UHFFFAOYSA-N
SMILES:N(CC)(CC)C=1N=C(Cl)C=CC1
Synonyms:- 2-Pyridinamine, 6-chloro-N,N-diethyl-
- 6-Chloro-N,N-diethyl-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.