CAS 1220017-45-7

Piperidine, 2-[2-[4-chloro-2-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[4-chloro-2-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a chloro-substituted phenyl group and a phenylmethyl moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the chloro group may influence its reactivity and interaction with biological targets. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions of synthesis and storage. Safety data and handling precautions are essential, as with any chemical, to mitigate risks associated with exposure or environmental impact.

Formula: C₂₀H₂₄ClNO·ClH

InChI: InChI=1S/C20H24ClNO.ClH/c21-18-9-10-20(23-13-11-19-8-4-5-12-22-19)17(15-18)14-16-6-2-1-3-7-16;/h1-3,6-7,9-10,15,19,22H,4-5,8,11-14H2;1H

InChI key: InChIKey=BAYOXXLPZOFBRI-UHFFFAOYSA-N

SMILES: C(C1=C(OCCC2CCCCN2)C=CC(Cl)=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 2-[2-[4-chloro-2-(phenylmethyl)phenoxy]ethyl]-, hydrochloride (1:1)