CAS 1220017-50-4

Piperidine, 3-[(2-bromo-4-chloro-3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(2-bromo-4-chloro-3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxy group substituted with bromine and chlorine atoms, as well as two methyl groups, contributing to its unique chemical properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to its structural components, which can interact with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. As with any chemical, thorough characterization and understanding of its reactivity, stability, and potential applications are essential for safe use.

Formula: C₁₄H₁₉BrClNO·ClH

InChI: InChI=1S/C14H19BrClNO.ClH/c1-9-6-12(13(15)10(2)14(9)16)18-8-11-4-3-5-17-7-11;/h6,11,17H,3-5,7-8H2,1-2H3;1H

InChI key: InChIKey=HCJYGXWWJRMOPX-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(Br)C(C)=C(Cl)C(C)=C2.Cl

Synonyms:

• Piperidine, 3-[(2-bromo-4-chloro-3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1)