CAS 1220017-52-6

1,3-Propanediamine, N3-(5-bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-, hydrochloride (1:1)

Description:

1,3-Propanediamine, N3-(5-bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a propanediamine backbone substituted with a pyridine ring. The presence of the bromine atom and the methyl groups on the pyridine contribute to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as being a potential ligand in coordination chemistry or serving as an intermediate in organic synthesis. Its specific interactions and stability can be influenced by the functional groups present, making it of interest in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as the presence of halogens and amines can indicate potential hazards. Overall, this compound represents a class of organic molecules that may have significant implications in chemical and biological research.

Formula: C₁₁H₁₈BrN₃·ClH

InChI: InChI=1S/C11H18BrN3.ClH/c1-9-7-10(12)8-14-11(9)13-5-4-6-15(2)3;/h7-8H,4-6H2,1-3H3,(H,13,14);1H

InChI key: InChIKey=RYGSEKDZYCZBMC-UHFFFAOYSA-N

SMILES: N(CCCN(C)C)C1=C(C)C=C(Br)C=N1.Cl

Synonyms:

• 1,3-Propanediamine, N3-(5-bromo-3-methyl-2-pyridinyl)-N1,N1-dimethyl-, hydrochloride (1:1)