CAS 1220017-54-8

Propanamide, 3-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This substance features a cyclohexyl group and an ethyl group attached to the nitrogen atom of the amide, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the amino group suggests potential basicity and reactivity, which may influence its interaction with biological systems. This compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure and functional groups can affect its melting point, solubility, and stability, which are critical for its application in drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₁H₂₂N₂O·ClH

InChI: InChI=1S/C11H22N2O.ClH/c1-2-13(11(14)8-9-12)10-6-4-3-5-7-10;/h10H,2-9,12H2,1H3;1H

InChI key: InChIKey=UTNKZZWMGKERHA-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)(CC)C1CCCCC1.Cl

Synonyms:

• Propanamide, 3-amino-N-cyclohexyl-N-ethyl-, hydrochloride (1:1)