CymitQuimica logo

CAS 1220017-60-6

:

2-[[3-Amino-4-(methylsulfonyl)phenyl]ethylamino]ethanol

Description:
2-[[3-Amino-4-(methylsulfonyl)phenyl]ethylamino]ethanol, identified by its CAS number 1220017-60-6, is a chemical compound characterized by its complex structure that includes an amino group, a methylsulfonyl group, and an ethanolamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methylsulfonyl group may enhance its stability and solubility in aqueous environments. Additionally, the compound may exhibit biological activity due to the amino groups, which can participate in various biochemical interactions. Its potential applications could span pharmaceuticals, where it may serve as a building block or active ingredient in drug formulations. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise determination. Overall, this compound's unique functional groups suggest it may play a role in medicinal chemistry and related fields.
Formula:C11H18N2O3S
InChI:InChI=1S/C11H18N2O3S/c1-3-13(6-7-14)9-4-5-11(10(12)8-9)17(2,15)16/h4-5,8,14H,3,6-7,12H2,1-2H3
InChI key:InChIKey=IZUZRLONCMZRFT-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(N)C=C(N(CCO)CC)C=C1
Synonyms:
  • 2-[[3-Amino-4-(methylsulfonyl)phenyl]ethylamino]ethanol
  • Ethanol, 2-[[3-amino-4-(methylsulfonyl)phenyl]ethylamino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.