CymitQuimica logo

CAS 1220017-75-3

:

6-Chloro-N-cyclohexyl-N-ethyl-2-pyridinamine

Description:
6-Chloro-N-cyclohexyl-N-ethyl-2-pyridinamine, identified by its CAS number 1220017-75-3, is a chemical compound that features a pyridine ring substituted with a chlorine atom and two distinct amine groups. The presence of the chloro group at the 6-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The cyclohexyl and ethyl groups attached to the nitrogen atoms enhance the compound's lipophilicity, which may influence its biological activity and solubility in organic solvents. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. Additionally, the structural characteristics suggest potential uses in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H19ClN2
InChI:InChI=1S/C13H19ClN2/c1-2-16(11-7-4-3-5-8-11)13-10-6-9-12(14)15-13/h6,9-11H,2-5,7-8H2,1H3
InChI key:InChIKey=PGBHCFSYLOPPGH-UHFFFAOYSA-N
SMILES:N(CC)(C=1N=C(Cl)C=CC1)C2CCCCC2
Synonyms:
  • 6-Chloro-N-cyclohexyl-N-ethyl-2-pyridinamine
  • 2-Pyridinamine, 6-chloro-N-cyclohexyl-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.