CAS 1220017-83-3

1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N,N-diethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N,N-diethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound features a carboxamide functional group, contributing to its potential biological activity. The presence of the diethyl substituent enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. The compound may exhibit a range of biological activities, making it of interest in drug development, particularly in the context of neurological or inflammatory disorders. Its specific interactions with biological targets would depend on its structural conformation and the presence of functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications in therapeutic contexts.

Formula: C₁₁H₁₈N₄O·ClH

InChI: InChI=1S/C11H18N4O.ClH/c1-3-15(4-2)11(16)10-8-7-12-6-5-9(8)13-14-10;/h12H,3-7H2,1-2H3,(H,13,14);1H

InChI key: InChIKey=MKWQVZYYUPJYAH-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C=1C2=C(NN1)CCNC2.Cl

Synonyms:

• 1H-Pyrazolo[4,3-c]pyridine-3-carboxamide, N,N-diethyl-4,5,6,7-tetrahydro-, hydrochloride (1:1)