CAS 1220017-90-2

2-Piperidineethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)

Description:

2-Piperidineethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the cyclohexyl and methyl groups suggests that this compound may exhibit lipophilic properties, which can influence its pharmacokinetics and interaction with biological membranes. Its structure may allow for interactions with neurotransmitter systems, making it of interest in medicinal chemistry. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound's unique structural features position it as a candidate for further research in drug development and related fields.

Formula: C₁₄H₂₈N₂·2ClH

InChI: InChI=1S/C14H28N2.2ClH/c1-16(14-8-3-2-4-9-14)12-10-13-7-5-6-11-15-13;;/h13-15H,2-12H2,1H3;2*1H

InChI key: InChIKey=UCOIYHWVMOHLCB-UHFFFAOYSA-N

SMILES: N(CCC1CCCCN1)(C)C2CCCCC2.Cl

Synonyms:

• 2-Piperidineethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)