
CAS 1220017-93-5
:Pyrrolidine, 3-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered nitrogen-containing heterocycle. The presence of a bromo substituent and a phenylmethyl group on the aromatic ring contributes to its unique properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological activities due to its structural features, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, due to potential toxicity or environmental impact. Overall, this compound represents a class of organic molecules that may have significant implications in research and therapeutic contexts.
Formula:C17H18BrNO·ClH
InChI:InChI=1S/C17H18BrNO.ClH/c18-16-11-14(10-13-4-2-1-3-5-13)6-7-17(16)20-15-8-9-19-12-15;/h1-7,11,15,19H,8-10,12H2;1H
InChI key:InChIKey=ARHZAEIFXOAKQA-UHFFFAOYSA-N
SMILES:C(C1=CC(Br)=C(OC2CCNC2)C=C1)C3=CC=CC=C3.Cl
Synonyms:- Pyrrolidine, 3-[2-bromo-4-(phenylmethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.