
CAS 1220017-94-6
:Piperidine, 3-(2-propoxyethoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(2-propoxyethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a propoxyethoxy substituent at the 3-position of the piperidine ring, contributing to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various pharmaceutical formulations. The presence of the ether group in the substituent may influence its lipophilicity and biological activity. Piperidine derivatives are often studied for their pharmacological properties, including potential roles as analgesics, antidepressants, or in other therapeutic areas. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of piperidine derivatives with potential applications in medicinal chemistry and drug development.
Formula:C10H21NO2·ClH
InChI:InChI=1S/C10H21NO2.ClH/c1-2-6-12-7-8-13-10-4-3-5-11-9-10;/h10-11H,2-9H2,1H3;1H
InChI key:InChIKey=CZMIBWXPPRGZEV-UHFFFAOYSA-N
SMILES:O(CCOCCC)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-(2-propoxyethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.