
CAS 1220017-98-0
:Piperidine, 3-[2-[[4-(1-methylethyl)phenyl]methoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-[[4-(1-methylethyl)phenyl]methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a side chain that includes a phenyl group substituted with an isopropyl group and a methoxyethyl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine structure often imparts basicity, allowing it to interact with biological systems effectively. This compound may exhibit psychoactive properties and is of interest in medicinal chemistry for its potential therapeutic effects. Its molecular interactions, stability, and reactivity can be influenced by the functional groups attached to the piperidine ring, making it a subject of study in drug development and synthesis. Safety and handling precautions should be observed due to its biological activity and potential toxicity.
Formula:C17H27NO·ClH
InChI:InChI=1S/C17H27NO.ClH/c1-14(2)17-7-5-16(6-8-17)13-19-11-9-15-4-3-10-18-12-15;/h5-8,14-15,18H,3-4,9-13H2,1-2H3;1H
InChI key:InChIKey=FLMXCUMRUOJWQX-UHFFFAOYSA-N
SMILES:C(OCCC1CCCNC1)C2=CC=C(C(C)C)C=C2.Cl
Synonyms:- Piperidine, 3-[2-[[4-(1-methylethyl)phenyl]methoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.