CAS 1220018-09-6
:5-Bromo-N-ethyl-3-methyl-2-pyridinamine
Description:
5-Bromo-N-ethyl-3-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a bromine atom at the 5-position and an ethyl group at the nitrogen atom contributes to its unique chemical properties. This compound is likely to exhibit moderate to high solubility in polar organic solvents due to the presence of the amino group, which can engage in hydrogen bonding. The bromine substituent may impart reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the methyl group at the 3-position can influence the steric and electronic properties of the molecule, affecting its reactivity and interaction with biological systems. As with many pyridine derivatives, this compound may possess biological activity, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as halogenated compounds can pose health risks.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-3-10-8-6(2)4-7(9)5-11-8/h4-5H,3H2,1-2H3,(H,10,11)
InChI key:InChIKey=KMKLOKUMLVZENM-UHFFFAOYSA-N
SMILES:N(CC)C1=C(C)C=C(Br)C=N1
Synonyms:- 2-Pyridinamine, 5-bromo-N-ethyl-3-methyl-
- 5-Bromo-N-ethyl-3-methyl-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.