CAS 1220018-12-1

Piperidine, 4-[(2-bromo-4-ethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(2-bromo-4-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-bromo-4-ethylphenoxy group attached to the piperidine at the 4-position, indicating the presence of a bromine atom and an ethyl group on a phenolic structure. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity due to the presence of the piperidine moiety, which is often associated with various pharmacological properties. The presence of the bromine substituent can influence its reactivity and potential applications in medicinal chemistry. Overall, this compound's unique structure suggests potential utility in research and development, particularly in the fields of pharmaceuticals and organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₄H₂₀BrNO·ClH

InChI: InChI=1S/C14H20BrNO.ClH/c1-2-11-3-4-14(13(15)9-11)17-10-12-5-7-16-8-6-12;/h3-4,9,12,16H,2,5-8,10H2,1H3;1H

InChI key: InChIKey=PFPMUSXFMGUKRD-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=C(Br)C=C(CC)C=C2.Cl

Synonyms:

• Piperidine, 4-[(2-bromo-4-ethylphenoxy)methyl]-, hydrochloride (1:1)