
CAS 1220018-26-7
:Piperidine, 3-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1), with CAS number 1220018-26-7, is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a chloro-substituted biphenyl moiety indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. The compound may exhibit various biological activities, potentially acting as a ligand or modulator in biochemical pathways. Its structure suggests that it could interact with specific receptors or enzymes, making it of interest in drug discovery. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and therapeutic potential.
Formula:C17H18ClNO·ClH
InChI:InChI=1S/C17H18ClNO.ClH/c18-16-11-14(13-5-2-1-3-6-13)8-9-17(16)20-15-7-4-10-19-12-15;/h1-3,5-6,8-9,11,15,19H,4,7,10,12H2;1H
InChI key:InChIKey=KQVUJAMNJCBQAD-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1OC2CCCNC2)C3=CC=CC=C3.Cl
Synonyms:- Piperidine, 3-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.