CymitQuimica logo

CAS 1220018-27-8

:

2-[(2-Hydroxyethyl)amino]-3-pyridinecarboxylic acid

Description:
2-[(2-Hydroxyethyl)amino]-3-pyridinecarboxylic acid, also known as a derivative of pyridine, is characterized by its functional groups that include a pyridine ring, a carboxylic acid, and a hydroxyethylamino moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl and amino groups, which can engage in hydrogen bonding. The carboxylic acid group contributes to its acidic nature, allowing it to participate in various chemical reactions, including esterification and amidation. Its structure suggests potential biological activity, making it of interest in pharmaceutical research. The compound may also exhibit chelating properties, which can be relevant in coordination chemistry. Additionally, the presence of the pyridine ring can influence its electronic properties, potentially affecting its reactivity and interaction with other molecules. Overall, this compound's unique combination of functional groups makes it a versatile candidate for various applications in organic synthesis and medicinal chemistry.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c11-5-4-10-7-6(8(12)13)2-1-3-9-7/h1-3,11H,4-5H2,(H,9,10)(H,12,13)
InChI key:InChIKey=FTLDWPXYMRSICF-UHFFFAOYSA-N
SMILES:N(CCO)C1=C(C(O)=O)C=CC=N1
Synonyms:
  • 3-Pyridinecarboxylic acid, 2-[(2-hydroxyethyl)amino]-
  • 2-[(2-Hydroxyethyl)amino]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.