CAS 1220018-60-9

Pyrrolidine, 3-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a chloro-substituted phenoxy group, indicating the presence of a chlorine atom and a phenolic moiety that is linked to the pyrrolidine via an ether bond. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and potentially influencing its pharmacological properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions, stability, and reactivity can be influenced by the presence of the chloro and isopropyl substituents on the phenyl ring. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula: C₁₃H₁₈ClNO·ClH

InChI: InChI=1S/C13H18ClNO.ClH/c1-9(2)10-3-4-13(12(14)7-10)16-11-5-6-15-8-11;/h3-4,7,9,11,15H,5-6,8H2,1-2H3;1H

InChI key: InChIKey=JKNHIGZRNQDFEW-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(C(C)C)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-[2-chloro-4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)