CymitQuimica logo

CAS 1220018-63-2

:

5-Bromo-3-methyl-N-2-propen-1-yl-2-pyridinamine

Description:
5-Bromo-3-methyl-N-2-propen-1-yl-2-pyridinamine is an organic compound characterized by its unique structure, which includes a bromine atom, a methyl group, and a propenyl substituent attached to a pyridine ring. The presence of the bromine atom suggests potential reactivity, particularly in nucleophilic substitution reactions. The compound features an amine functional group, which can participate in hydrogen bonding and may influence its solubility and reactivity. The pyridine ring contributes to the compound's aromaticity, enhancing stability and influencing electronic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. Overall, 5-Bromo-3-methyl-N-2-propen-1-yl-2-pyridinamine is a versatile compound with potential applications in medicinal chemistry and materials science, though specific applications would depend on further research and characterization.
Formula:C9H11BrN2
InChI:InChI=1S/C9H11BrN2/c1-3-4-11-9-7(2)5-8(10)6-12-9/h3,5-6H,1,4H2,2H3,(H,11,12)
InChI key:InChIKey=YCTXWYSUCLXJMJ-UHFFFAOYSA-N
SMILES:N(CC=C)C1=C(C)C=C(Br)C=N1
Synonyms:
  • 5-Bromo-3-methyl-N-2-propen-1-yl-2-pyridinamine
  • 2-Pyridinamine, 5-bromo-3-methyl-N-2-propen-1-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.