CAS 1220018-70-1

1H-Indole, 2,3-dihydro-1-(3-pyrrolidinylmethyl)-, hydrochloride (1:2)

Description:

1H-Indole, 2,3-dihydro-1-(3-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the 2,3-dihydro group indicates that the compound has a saturated bond in the indole framework, contributing to its stability and reactivity. The pyrrolidinylmethyl substituent suggests that the compound has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the nitrogen-containing heterocycle that can interact with biological targets. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability. The compound's molecular interactions, including hydrogen bonding and potential receptor binding, make it of interest in various research fields, including neuropharmacology and drug design. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₃H₁₈N₂·2ClH

InChI: InChI=1S/C13H18N2.2ClH/c1-2-4-13-12(3-1)6-8-15(13)10-11-5-7-14-9-11;;/h1-4,11,14H,5-10H2;2*1H

InChI key: InChIKey=WCUUIJLBEHAPTI-UHFFFAOYSA-N

SMILES: C(N1C=2C(CC1)=CC=CC2)C3CCNC3.Cl

Synonyms:

• 1H-Indole, 2,3-dihydro-1-(3-pyrrolidinylmethyl)-, hydrochloride (1:2)