CAS 1220018-78-9

2-Piperidinemethanamine, N,N-dipropyl-, hydrochloride (1:2)

Description:

2-Piperidinemethanamine, N,N-dipropyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a dipropylamine substituent, indicating the presence of two propyl groups attached to the nitrogen atom of the piperidine. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and stability. As a tertiary amine, it exhibits basic properties and can participate in various chemical reactions, including nucleophilic substitutions. The presence of the hydrochloride salt often indicates potential applications in pharmaceuticals or as a reagent in organic synthesis. Its molecular structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₂H₂₆N₂·2ClH

InChI: InChI=1S/C12H26N2.2ClH/c1-3-9-14(10-4-2)11-12-7-5-6-8-13-12;;/h12-13H,3-11H2,1-2H3;2*1H

InChI key: InChIKey=XACULDMTKGCEMQ-UHFFFAOYSA-N

SMILES: N(CC1CCCCN1)(CCC)CCC.Cl

Synonyms:

• 2-Piperidinemethanamine, N,N-dipropyl-, hydrochloride (1:2)