CymitQuimica logo

CAS 1220018-83-6

:

Piperidine, 3-[4-bromo-2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)

Description:
Piperidine, 3-[4-bromo-2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a bromo substituent and a bulky tert-butyl group on the phenoxy moiety contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, making it useful in various chemical applications. The bromo group can participate in nucleophilic substitution reactions, while the piperidine ring can act as a base or nucleophile in organic synthesis. Additionally, the compound may exhibit biological activity, potentially influencing its use in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C15H22BrNO·ClH
InChI:InChI=1S/C15H22BrNO.ClH/c1-15(2,3)13-9-11(16)6-7-14(13)18-12-5-4-8-17-10-12;/h6-7,9,12,17H,4-5,8,10H2,1-3H3;1H
InChI key:InChIKey=SXYJVWYYJWCIKT-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)(C)C)C=C(Br)C=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-[4-bromo-2-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.