CAS 1220018-90-5

2-Chloro-N-(3-hydroxybutyl)-3-pyridinecarboxamide

Description:

2-Chloro-N-(3-hydroxybutyl)-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring, which is substituted with a chloro group and an amide functional group. The presence of the hydroxybutyl side chain contributes to its solubility and potential biological activity. This compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its reactivity and interaction with biological systems. The chloro substituent can enhance the compound's lipophilicity and may affect its pharmacokinetic properties. Additionally, the hydroxyl group can participate in hydrogen bonding, potentially impacting its solubility in polar solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many chemical substances, its safety, handling, and environmental impact should be assessed in accordance with regulatory guidelines. Overall, 2-Chloro-N-(3-hydroxybutyl)-3-pyridinecarboxamide presents a unique combination of functional groups that may confer interesting chemical and biological properties.

Formula: C₁₀H₁₃ClN₂O₂

InChI: InChI=1S/C10H13ClN2O2/c1-7(14)4-6-13-10(15)8-3-2-5-12-9(8)11/h2-3,5,7,14H,4,6H2,1H3,(H,13,15)

InChI key: InChIKey=XYJJMZFWGBIEBJ-UHFFFAOYSA-N

SMILES: C(NCCC(C)O)(=O)C1=C(Cl)N=CC=C1

Synonyms:

• 3-Pyridinecarboxamide, 2-chloro-N-(3-hydroxybutyl)-
• 2-Chloro-N-(3-hydroxybutyl)-3-pyridinecarboxamide