CymitQuimica logo

CAS 1220018-91-6

:

1-Piperazineethanol, 4-(2-piperidinylmethyl)-, hydrochloride (1:2)

Description:
1-Piperazineethanol, 4-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and piperidine moieties, which contribute to its potential pharmacological properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its ionic nature due to the presence of the hydrochloride salt form. The compound's structure suggests it may exhibit basic properties, as piperazine and piperidine are known for their ability to act as bases. Its molecular configuration allows for potential interactions with various biological targets, making it of interest in medicinal chemistry. The compound may be utilized in research settings, particularly in studies related to neuropharmacology or as a potential therapeutic agent. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for biological activity and the need for proper laboratory practices.
Formula:C12H25N3O·2ClH
InChI:InChI=1S/C12H25N3O.2ClH/c16-10-9-14-5-7-15(8-6-14)11-12-3-1-2-4-13-12;;/h12-13,16H,1-11H2;2*1H
InChI key:InChIKey=DQLBLEWHXJZNGU-UHFFFAOYSA-N
SMILES:C(N1CCN(CCO)CC1)C2CCCCN2.Cl
Synonyms:
  • 1-Piperazineethanol, 4-(2-piperidinylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.