
CAS 1220019-06-6
:Pyrrolidine, 3-(4-iodophenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(4-iodophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-iodophenoxy group indicates that the compound has a phenolic moiety substituted with iodine at the para position, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit biological activity due to the presence of the pyrrolidine and phenoxy groups, which can interact with biological targets. Its molecular interactions, stability, and reactivity can be influenced by the presence of the iodine substituent, which can affect electronic properties and steric hindrance. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents, which may pose specific health risks.
Formula:C10H12INO·ClH
InChI:InChI=1S/C10H12INO.ClH/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10;/h1-4,10,12H,5-7H2;1H
InChI key:InChIKey=KBCDLDAVLARFGX-UHFFFAOYSA-N
SMILES:O(C1=CC=C(I)C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(4-iodophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.