
CAS 1220019-10-2
:4-Piperidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1)
Description:
4-Piperidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. The presence of the carboxamide functional group indicates that it can engage in hydrogen bonding, enhancing its solubility in polar solvents. The N-(3-hydroxybutyl) substituent introduces a hydroxyl group, which may influence the compound's reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, including potential analgesic or anti-inflammatory effects, although specific biological activities would require empirical investigation. Its molecular structure suggests it could interact with various receptors or enzymes, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C10H20N2O2·ClH
InChI:InChI=1S/C10H20N2O2.ClH/c1-8(13)2-7-12-10(14)9-3-5-11-6-4-9;/h8-9,11,13H,2-7H2,1H3,(H,12,14);1H
InChI key:InChIKey=JMUMEGMUILZSOI-UHFFFAOYSA-N
SMILES:C(NCCC(C)O)(=O)C1CCNCC1.Cl
Synonyms:- 4-Piperidinecarboxamide, N-(3-hydroxybutyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.