
CAS 1220019-13-5
:Ethanol, 2-[methyl(2-pyrrolidinylmethyl)amino]-, hydrochloride (1:2)
Description:
Ethanol, 2-[methyl(2-pyrrolidinylmethyl)amino]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes an ethanol backbone and a pyrrolidine moiety. This substance is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrrolidine derivatives are often associated with various biological activities. The compound's hydrochloride form indicates that it is likely to be a stable, crystalline solid at room temperature, with a tendency to form hygroscopic properties. Its molecular interactions may involve hydrogen bonding due to the presence of amino groups, which can affect its reactivity and solubility. As with many compounds containing nitrogen, it may exhibit basic characteristics. Overall, this compound's unique structural features and properties make it of interest in both research and potential therapeutic applications.
Formula:C8H18N2O·2ClH
InChI:InChI=1S/C8H18N2O.2ClH/c1-10(5-6-11)7-8-3-2-4-9-8;;/h8-9,11H,2-7H2,1H3;2*1H
InChI key:InChIKey=RMMDDGMLLKXATB-UHFFFAOYSA-N
SMILES:C(N(CCO)C)C1CCCN1.Cl
Synonyms:- Ethanol, 2-[methyl(2-pyrrolidinylmethyl)amino]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.