CAS 1220019-14-6

Acetamide, 2-amino-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(1-methylpropyl)-, hydrochloride (1:1), with the CAS number 1220019-14-6, is a chemical compound characterized by its amide functional group and the presence of a hydrochloride salt. This substance typically exhibits properties associated with amides, such as moderate solubility in polar solvents like water due to the presence of the hydrochloride moiety, which enhances its ionic character. The compound features a branched alkyl group, which can influence its steric properties and biological activity. As a hydrochloride salt, it is likely to be more stable and easier to handle compared to its free base form. The presence of the amino group suggests potential for hydrogen bonding, which can affect its reactivity and interactions in biological systems. Overall, this compound may have applications in pharmaceuticals or biochemistry, although specific uses would depend on its biological activity and further characterization. Safety data and handling precautions should be consulted, as with any chemical substance.

Formula: C₆H₁₄N₂O·ClH

InChI: InChI=1S/C6H14N2O.ClH/c1-3-5(2)8-6(9)4-7;/h5H,3-4,7H2,1-2H3,(H,8,9);1H

InChI key: InChIKey=QZEPMKVWIJNEFN-UHFFFAOYSA-N

SMILES: N(C(CC)C)C(CN)=O.Cl

Synonyms:

• Acetamide, 2-amino-N-(1-methylpropyl)-, hydrochloride (1:1)