CymitQuimica logo

CAS 1220019-16-8

:

3-Amino-4-chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]benzenesulfonamide

Description:
3-Amino-4-chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of an amino group and a chloro substituent on the benzene ring contributes to its reactivity and potential biological activity. The tetrahydro-2H-pyran moiety introduces a cyclic ether structure, which can influence the compound's solubility and interaction with biological targets. This compound may exhibit properties such as moderate to high polarity due to the sulfonamide and amino groups, making it soluble in polar solvents. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. Additionally, the presence of the chloro group may enhance its reactivity in various chemical reactions. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and development in chemical and pharmaceutical sciences.
Formula:C12H17ClN2O3S
InChI:InChI=1S/C12H17ClN2O3S/c13-11-2-1-10(7-12(11)14)19(16,17)15-8-9-3-5-18-6-4-9/h1-2,7,9,15H,3-6,8,14H2
InChI key:InChIKey=HFPFXHCCYQDNPF-UHFFFAOYSA-N
SMILES:S(NCC1CCOCC1)(=O)(=O)C2=CC(N)=C(Cl)C=C2
Synonyms:
  • 3-Amino-4-chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]benzenesulfonamide
  • Benzenesulfonamide, 3-amino-4-chloro-N-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.