
CAS 1220019-20-4
:Pyrrolidine, 3-[(3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 3,5-dimethylphenoxy group indicates that the compound has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its hydrochloride form suggests that it can be used in a stable, solid state, making it suitable for storage and handling in laboratory settings. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.
Formula:C13H19NO·ClH
InChI:InChI=1S/C13H19NO.ClH/c1-10-5-11(2)7-13(6-10)15-9-12-3-4-14-8-12;/h5-7,12,14H,3-4,8-9H2,1-2H3;1H
InChI key:InChIKey=YOVVGBYQNWJFNI-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=CC(C)=CC(C)=C2.Cl
Synonyms:- Pyrrolidine, 3-[(3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.