CymitQuimica logo

CAS 1220019-24-8

:

4-[(6-Chloro-2-pyrazinyl)amino]-2-butanol

Description:
4-[(6-Chloro-2-pyrazinyl)amino]-2-butanol, identified by its CAS number 1220019-24-8, is a chemical compound characterized by its unique structural features, including a butanol backbone and a pyrazine ring substituted with a chlorine atom. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the chloro group may impart specific electronic and steric effects, potentially affecting its biological activity and interaction with other molecules. As a result, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, 4-[(6-Chloro-2-pyrazinyl)amino]-2-butanol represents a class of compounds that could have significant applications in medicinal chemistry and related fields.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-6(13)2-3-11-8-5-10-4-7(9)12-8/h4-6,13H,2-3H2,1H3,(H,11,12)
InChI key:InChIKey=RFFNGKINDVZQPD-UHFFFAOYSA-N
SMILES:N(CCC(C)O)C1=NC(Cl)=CN=C1
Synonyms:
  • 2-Butanol, 4-[(6-chloro-2-pyrazinyl)amino]-
  • 4-[(6-Chloro-2-pyrazinyl)amino]-2-butanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.